C28H54O4Si2 — CID 177476925
(E)-2-methyl-3-[(4S,5S,6R,7S)-4-methyl-6-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]-7-pentyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]prop-2-enal (PubChem CID 177476925) has the molecular formula C28H54O4Si2 and a molecular weight of 510.91 g/mol. Its IUPAC name is (E)-2-methyl-3-[(4S,5S,6R,7S)-4-methyl-6-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]-7-pentyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]prop-2-enal.
| Compound Name | (E)-2-methyl-3-[(4S,5S,6R,7S)-4-methyl-6-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]-7-pentyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]prop-2-enal |
|---|---|
| PubChem CID | 177476925 |
| Molecular Formula | C28H54O4Si2 |
| Molecular Weight | 510.91 g/mol |
| Exact Mass | 510.36 |
| IUPAC Name | (E)-2-methyl-3-[(4S,5S,6R,7S)-4-methyl-6-[(E)-2-methyl-3-trimethylsilylprop-2-enyl]-7-pentyl-5-triethylsilyloxy-1,3-dioxepan-4-yl]prop-2-enal |
| SMILES | CCCCC[C@@H]1OCO[C@@](C)(/C=C(\C)C=O)[C@@H](O[Si](CC)(CC)CC)[C@@H]1C/C(C)=C/[Si](C)(C)C |
| InChI | InChI=1S/C28H54O4Si2/c1-11-15-16-17-26-25(18-23(5)21-33(8,9)10)27(32-34(12-2,13-3)14-4)28(7,31-22-30-26)19-24(6)20-29/h19-21,25-27H,11-18,22H2,1-10H3/b23-21+,24-19+/t25-,26+,27+,28+/m1/s1 |
| InChIKey | HOMFUXUSHCAKPR-GYMBRVMSSA-N |
| XLogP | 8.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.91 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|