C20H30Si2 — CID 177477315
[5-(cyclohexen-1-yl)-1,1-dimethyl-2,3-dihydrosilol-4-yl]-dimethyl-phenylsilane (PubChem CID 177477315) has the molecular formula C20H30Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is [5-(cyclohexen-1-yl)-1,1-dimethyl-2,3-dihydrosilol-4-yl]-dimethyl-phenylsilane.
| Compound Name | [5-(cyclohexen-1-yl)-1,1-dimethyl-2,3-dihydrosilol-4-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 177477315 |
| Molecular Formula | C20H30Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | [5-(cyclohexen-1-yl)-1,1-dimethyl-2,3-dihydrosilol-4-yl]-dimethyl-phenylsilane |
| SMILES | C[Si]1(C)CCC([Si](C)(C)c2ccccc2)=C1C1=CCCCC1 |
| InChI | InChI=1S/C20H30Si2/c1-21(2)16-15-19(20(21)17-11-7-5-8-12-17)22(3,4)18-13-9-6-10-14-18/h6,9-11,13-14H,5,7-8,12,15-16H2,1-4H3 |
| InChIKey | XCVUNPIFZQOLLO-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|