About propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane)
propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) (PubChem CID 177477519) has the molecular formula C42H46P2Sb2
and a molecular weight of 856.30 g/mol. Its IUPAC name is propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane).
Molecular Properties
| Compound Name | propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) |
| PubChem CID | 177477519 |
| Molecular Formula | C42H46P2Sb2 |
| Molecular Weight | 856.30 g/mol |
| Exact Mass | 854.12 |
| IUPAC Name | propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) |
| SMILES | CC(C)PPC(C)C.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C6H16P2.6C6H5.2Sb/c1-5(2)7-8-6(3)4;6*1-2-4-6-5-3-1;;/h5-8H,1-4H3;6*1-5H;; |
| InChIKey | NJIPUCAFXQNYAR-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 856.30 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane)?
The IUPAC name of propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) (CID 177477519) is propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane).
What is the SMILES notation for propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane)?
The canonical SMILES for propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) is CC(C)PPC(C)C.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1.c1ccc([Sb](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane)?
The InChIKey is NJIPUCAFXQNYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16P2.6C6H5.2Sb/c1-5(2)7-8-6(3)4;6*1-2-4-6-5-3-1;;/h5-8H,1-4H3;6*1-5H;;.
What are the key properties of propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane)?
propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) has a molecular weight of 856.30 g/mol, XLogP of 7.48, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl(propan-2-ylphosphanyl)phosphane;bis(triphenylstibane) is sourced from PubChem (CID 177477519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).