About triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide
triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide (PubChem CID 177477725) has the molecular formula C18H37BN2O
and a molecular weight of 308.32 g/mol. Its IUPAC name is triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide.
Molecular Properties
| Compound Name | triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide |
| PubChem CID | 177477725 |
| Molecular Formula | C18H37BN2O |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.30 |
| IUPAC Name | triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide |
| SMILES | CC[B-](CC)(CC)c1n(C(C)C)cc[n+]1CC(O)C(C)(C)C |
| InChI | InChI=1S/C18H37BN2O/c1-9-19(10-2,11-3)17-20(12-13-21(17)15(4)5)14-16(22)18(6,7)8/h12-13,15-16,22H,9-11,14H2,1-8H3 |
| InChIKey | QTBOCHNHSZWAIT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide?
The IUPAC name of triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide (CID 177477725) is triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide.
What is the SMILES notation for triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide?
The canonical SMILES for triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide is CC[B-](CC)(CC)c1n(C(C)C)cc[n+]1CC(O)C(C)(C)C.
What is the InChIKey of triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide?
The InChIKey is QTBOCHNHSZWAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37BN2O/c1-9-19(10-2,11-3)17-20(12-13-21(17)15(4)5)14-16(22)18(6,7)8/h12-13,15-16,22H,9-11,14H2,1-8H3.
What are the key properties of triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide?
triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide has a molecular weight of 308.32 g/mol, XLogP of 3.48, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[1-(2-hydroxy-3,3-dimethylbutyl)-3-propan-2-ylimidazol-1-ium-2-yl]boranuide is sourced from PubChem (CID 177477725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).