About [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate
[(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate (PubChem CID 177477970) has the molecular formula C9H8N2O5S
and a molecular weight of 256.24 g/mol. Its IUPAC name is [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate.
Molecular Properties
| Compound Name | [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate |
| PubChem CID | 177477970 |
| Molecular Formula | C9H8N2O5S |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate |
| SMILES | O=[N+]([O-])O[C@H]1S[C@@H](c2ccccc2)[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N2O5S/c12-10(13)7-8(6-4-2-1-3-5-6)17-9(7)16-11(14)15/h1-5,7-9H/t7-,8-,9-/m0/s1 |
| InChIKey | HOZSXIKGSXDTLV-CIUDSAMLSA-N |
| XLogP | 1.65 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate?
The IUPAC name of [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate (CID 177477970) is [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate.
What is the SMILES notation for [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate?
The canonical SMILES for [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate is O=[N+]([O-])O[C@H]1S[C@@H](c2ccccc2)[C@@H]1[N+](=O)[O-].
What is the InChIKey of [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate?
The InChIKey is HOZSXIKGSXDTLV-CIUDSAMLSA-N. The full InChI is InChI=1S/C9H8N2O5S/c12-10(13)7-8(6-4-2-1-3-5-6)17-9(7)16-11(14)15/h1-5,7-9H/t7-,8-,9-/m0/s1.
What are the key properties of [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate?
[(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate has a molecular weight of 256.24 g/mol, XLogP of 1.65, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S,4S)-3-nitro-4-phenylthietan-2-yl] nitrate is sourced from PubChem (CID 177477970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).