C28H43NO6 — CID 177478548
(5S,6R,11R)-5-benzyl-10-heptyl-6-hydroxy-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione (PubChem CID 177478548) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is (5S,6R,11R)-5-benzyl-10-heptyl-6-hydroxy-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione.
| Compound Name | (5S,6R,11R)-5-benzyl-10-heptyl-6-hydroxy-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
|---|---|
| PubChem CID | 177478548 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | (5S,6R,11R)-5-benzyl-10-heptyl-6-hydroxy-4,11-dimethyl-2-propan-2-yl-1,9-dioxa-4-azacyclododecane-3,8,12-trione |
| SMILES | CCCCCCCC1OC(=O)C[C@@H](O)[C@H](Cc2ccccc2)N(C)C(=O)C(C(C)C)OC(=O)[C@@H]1C |
| InChI | InChI=1S/C28H43NO6/c1-6-7-8-9-13-16-24-20(4)28(33)35-26(19(2)3)27(32)29(5)22(23(30)18-25(31)34-24)17-21-14-11-10-12-15-21/h10-12,14-15,19-20,22-24,26,30H,6-9,13,16-18H2,1-5H3/t20-,22+,23-,24?,26?/m1/s1 |
| InChIKey | NJNAHFYVTBZQHU-BYZOUHGPSA-N |
| XLogP | 4.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|