C16H25NO4 — CID 177478829
(1S,2S,10S,13R,14R,15S)-2,14-dihydroxy-15-methyl-6-oxido-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one (PubChem CID 177478829) has the molecular formula C16H25NO4 and a molecular weight of 295.38 g/mol. Its IUPAC name is (1S,2S,10S,13R,14R,15S)-2,14-dihydroxy-15-methyl-6-oxido-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one.
| Compound Name | (1S,2S,10S,13R,14R,15S)-2,14-dihydroxy-15-methyl-6-oxido-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
|---|---|
| PubChem CID | 177478829 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | (1S,2S,10S,13R,14R,15S)-2,14-dihydroxy-15-methyl-6-oxido-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
| SMILES | C[C@H]1C[C@@]23[C@@H]4CCC[N+]2([O-])CCC[C@]3(O)[C@H](CC4=O)[C@@H]1O |
| InChI | InChI=1S/C16H25NO4/c1-10-9-15-11-4-2-6-17(15,21)7-3-5-16(15,20)12(14(10)19)8-13(11)18/h10-12,14,19-20H,2-9H2,1H3/t10-,11+,12+,14+,15-,16-,17?/m0/s1 |
| InChIKey | IGVAYTKOVZGEKF-RJKRUPAQSA-N |
| XLogP | 0.96 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|