C21H30O6 — CID 177479160
dimethyl (3E,5E,7S,8S,11Z)-8-methoxy-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate (PubChem CID 177479160) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is dimethyl (3E,5E,7S,8S,11Z)-8-methoxy-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate.
| Compound Name | dimethyl (3E,5E,7S,8S,11Z)-8-methoxy-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 177479160 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | dimethyl (3E,5E,7S,8S,11Z)-8-methoxy-7,11-dimethyl-13-oxocyclotetradeca-3,5,11-triene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C=C/C=C/[C@H](C)[C@@H](OC)CC/C(C)=C\C(=O)C1 |
| InChI | InChI=1S/C21H30O6/c1-15-10-11-18(25-3)16(2)9-7-6-8-12-21(19(23)26-4,20(24)27-5)14-17(22)13-15/h6-9,13,16,18H,10-12,14H2,1-5H3/b8-6+,9-7+,15-13-/t16-,18-/m0/s1 |
| InChIKey | HBZITVIECJRNGK-LGKHUZOVSA-N |
| XLogP | 3.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|