C7HF12O8S4- — CID 177479465
1,1,3,3-tetrakis(trifluoromethylsulfonyl)prop-1-ene (PubChem CID 177479465) has the molecular formula C7HF12O8S4- and a molecular weight of 569.32 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(trifluoromethylsulfonyl)prop-1-ene.
| Compound Name | 1,1,3,3-tetrakis(trifluoromethylsulfonyl)prop-1-ene |
|---|---|
| PubChem CID | 177479465 |
| Molecular Formula | C7HF12O8S4- |
| Molecular Weight | 569.32 g/mol |
| Exact Mass | 568.84 |
| IUPAC Name | 1,1,3,3-tetrakis(trifluoromethylsulfonyl)prop-1-ene |
| SMILES | O=S(=O)(C(=C[C-](S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7HF12O8S4/c8-4(9,10)28(20,21)2(29(22,23)5(11,12)13)1-3(30(24,25)6(14,15)16)31(26,27)7(17,18)19/h1H/q-1 |
| InChIKey | LTTMSSLWVIKHSY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 136.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|