C13H14NO2P — CID 177479553
cyclopenta-1,2,4-trien-1-yl-dimethoxy-phenylimino-λ5-phosphane (PubChem CID 177479553) has the molecular formula C13H14NO2P and a molecular weight of 247.23 g/mol. Its IUPAC name is cyclopenta-1,2,4-trien-1-yl-dimethoxy-phenylimino-λ5-phosphane.
| Compound Name | cyclopenta-1,2,4-trien-1-yl-dimethoxy-phenylimino-λ5-phosphane |
|---|---|
| PubChem CID | 177479553 |
| Molecular Formula | C13H14NO2P |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | cyclopenta-1,2,4-trien-1-yl-dimethoxy-phenylimino-λ5-phosphane |
| SMILES | COP(=Nc1ccccc1)(OC)C1=C=CC=C1 |
| InChI | InChI=1S/C13H14NO2P/c1-15-17(16-2,13-10-6-7-11-13)14-12-8-4-3-5-9-12/h3-10H,1-2H3 |
| InChIKey | SWCLFLNGZTZCAO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|