C11H20F3NOS — CID 177479582
2-methyl-N-(1,1,1-trifluoro-2,4-dimethylpent-4-en-2-yl)propane-2-sulfinamide (PubChem CID 177479582) has the molecular formula C11H20F3NOS and a molecular weight of 271.35 g/mol. Its IUPAC name is 2-methyl-N-(1,1,1-trifluoro-2,4-dimethylpent-4-en-2-yl)propane-2-sulfinamide.
| Compound Name | 2-methyl-N-(1,1,1-trifluoro-2,4-dimethylpent-4-en-2-yl)propane-2-sulfinamide |
|---|---|
| PubChem CID | 177479582 |
| Molecular Formula | C11H20F3NOS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-methyl-N-(1,1,1-trifluoro-2,4-dimethylpent-4-en-2-yl)propane-2-sulfinamide |
| SMILES | C=C(C)CC(C)(NS(=O)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C11H20F3NOS/c1-8(2)7-10(6,11(12,13)14)15-17(16)9(3,4)5/h15H,1,7H2,2-6H3 |
| InChIKey | GGDFKDJGHAWWFX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|