C13H8F6N2 — CID 177480515
1-(3,3,4,4,5,5-hexafluoro-2-pyrrol-1-ylcyclopenten-1-yl)pyrrole (PubChem CID 177480515) has the molecular formula C13H8F6N2 and a molecular weight of 306.21 g/mol. Its IUPAC name is 1-(3,3,4,4,5,5-hexafluoro-2-pyrrol-1-ylcyclopenten-1-yl)pyrrole.
| Compound Name | 1-(3,3,4,4,5,5-hexafluoro-2-pyrrol-1-ylcyclopenten-1-yl)pyrrole |
|---|---|
| PubChem CID | 177480515 |
| Molecular Formula | C13H8F6N2 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-(3,3,4,4,5,5-hexafluoro-2-pyrrol-1-ylcyclopenten-1-yl)pyrrole |
| SMILES | FC1(F)C(n2cccc2)=C(n2cccc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C13H8F6N2/c14-11(15)9(20-5-1-2-6-20)10(21-7-3-4-8-21)12(16,17)13(11,18)19/h1-8H |
| InChIKey | RFSJSPWWGMTTKO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|