C21H30N2O7 — CID 177481544
methyl (2S)-2-[acetyloxymethyl-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoate (PubChem CID 177481544) has the molecular formula C21H30N2O7 and a molecular weight of 422.48 g/mol. Its IUPAC name is methyl (2S)-2-[acetyloxymethyl-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[acetyloxymethyl-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 177481544 |
| Molecular Formula | C21H30N2O7 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | methyl (2S)-2-[acetyloxymethyl-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N(COC(C)=O)C(=O)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H30N2O7/c1-14(22-20(27)30-21(3,4)5)18(25)23(13-29-15(2)24)17(19(26)28-6)12-16-10-8-7-9-11-16/h7-11,14,17H,12-13H2,1-6H3,(H,22,27)/t14-,17-/m0/s1 |
| InChIKey | KJPLMEAQTQGXKO-YOEHRIQHSA-N |
| XLogP | 2.03 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|