About CID 177481752
CID 177481752 (PubChem CID 177481752) has the molecular formula C26H18FN2Si
and a molecular weight of 405.53 g/mol.
Molecular Properties
| Compound Name | CID 177481752 |
| PubChem CID | 177481752 |
| Molecular Formula | C26H18FN2Si |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | — |
| SMILES | Fc1ccc([Si](c2ccccc2)c2ccccc2)c2nc(-c3ccccn3)ccc12 |
| InChI | InChI=1S/C26H18FN2Si/c27-22-15-17-25(26-21(22)14-16-24(29-26)23-13-7-8-18-28-23)30(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-18H |
| InChIKey | WGYCEYXYNHIIOR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze CID 177481752 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177481752?
The IUPAC name of CID 177481752 (CID 177481752) is not available.
What is the SMILES notation for CID 177481752?
The canonical SMILES for CID 177481752 is Fc1ccc([Si](c2ccccc2)c2ccccc2)c2nc(-c3ccccn3)ccc12.
What is the InChIKey of CID 177481752?
The InChIKey is WGYCEYXYNHIIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18FN2Si/c27-22-15-17-25(26-21(22)14-16-24(29-26)23-13-7-8-18-28-23)30(19-9-3-1-4-10-19)20-11-5-2-6-12-20/h1-18H.
What are the key properties of CID 177481752?
CID 177481752 has a molecular weight of 405.53 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177481752 is sourced from PubChem (CID 177481752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).