About CID 177482375
CID 177482375 (PubChem CID 177482375) has the molecular formula C2H11NO4Si2Sm-
and a molecular weight of 319.65 g/mol.
Molecular Properties
| Compound Name | CID 177482375 |
| PubChem CID | 177482375 |
| Molecular Formula | C2H11NO4Si2Sm- |
| Molecular Weight | 319.65 g/mol |
| Exact Mass | 320.94 |
| IUPAC Name | — |
| SMILES | C[Si](C)[NH-].O[Si](O)(O)O.[Sm] |
| InChI | InChI=1S/C2H7NSi.H4O4Si.Sm/c1-4(2)3;1-5(2,3)4;/h3H,1-2H3;1-4H;/q-1;; |
| InChIKey | CBHGNSLVUWYNLF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 104.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.65 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177482375 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177482375?
The IUPAC name of CID 177482375 (CID 177482375) is not available.
What is the SMILES notation for CID 177482375?
The canonical SMILES for CID 177482375 is C[Si](C)[NH-].O[Si](O)(O)O.[Sm].
What is the InChIKey of CID 177482375?
The InChIKey is CBHGNSLVUWYNLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NSi.H4O4Si.Sm/c1-4(2)3;1-5(2,3)4;/h3H,1-2H3;1-4H;/q-1;;.
What are the key properties of CID 177482375?
CID 177482375 has a molecular weight of 319.65 g/mol, XLogP of -1.32, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177482375 is sourced from PubChem (CID 177482375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).