C16H35NO6Si3 — CID 177482496
(3Z,4S,5R)-5-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-methoxyimino-4-trimethylsilyloxyoxolan-2-one (PubChem CID 177482496) has the molecular formula C16H35NO6Si3 and a molecular weight of 421.72 g/mol. Its IUPAC name is (3Z,4S,5R)-5-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-methoxyimino-4-trimethylsilyloxyoxolan-2-one.
| Compound Name | (3Z,4S,5R)-5-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-methoxyimino-4-trimethylsilyloxyoxolan-2-one |
|---|---|
| PubChem CID | 177482496 |
| Molecular Formula | C16H35NO6Si3 |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | (3Z,4S,5R)-5-[(1S)-1,2-bis(trimethylsilyloxy)ethyl]-3-methoxyimino-4-trimethylsilyloxyoxolan-2-one |
| SMILES | CO/N=C1\C(=O)O[C@@H]([C@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C16H35NO6Si3/c1-19-17-13-15(23-26(8,9)10)14(21-16(13)18)12(22-25(5,6)7)11-20-24(2,3)4/h12,14-15H,11H2,1-10H3/b17-13-/t12-,14-,15-/m0/s1 |
| InChIKey | HGUXLJFEHRQBOG-OUWHLROYSA-N |
| XLogP | 3.21 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|