C21H38O3Si — CID 177483064
(2E)-2-[(6R)-6-[(1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-ylcyclopentyl]oxan-3-ylidene]ethanol (PubChem CID 177483064) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (2E)-2-[(6R)-6-[(1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-ylcyclopentyl]oxan-3-ylidene]ethanol.
| Compound Name | (2E)-2-[(6R)-6-[(1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-ylcyclopentyl]oxan-3-ylidene]ethanol |
|---|---|
| PubChem CID | 177483064 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (2E)-2-[(6R)-6-[(1R,2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-prop-1-en-2-ylcyclopentyl]oxan-3-ylidene]ethanol |
| SMILES | C=C(C)[C@H]1CC[C@H]([C@H]2CC/C(=C\CO)CO2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H38O3Si/c1-15(2)17-9-10-18(19-11-8-16(12-13-22)14-23-19)20(17)24-25(6,7)21(3,4)5/h12,17-20,22H,1,8-11,13-14H2,2-7H3/b16-12+/t17-,18-,19-,20+/m1/s1 |
| InChIKey | BDYDNTRWDKYZGQ-BILGURBUSA-N |
| XLogP | 5.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|