C13H22 — CID 177483288
(1Z,2E)-1,2-di(butylidene)cyclopentane (PubChem CID 177483288) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is (1Z,2E)-1,2-di(butylidene)cyclopentane.
| Compound Name | (1Z,2E)-1,2-di(butylidene)cyclopentane |
|---|---|
| PubChem CID | 177483288 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (1Z,2E)-1,2-di(butylidene)cyclopentane |
| SMILES | CCC/C=C1/CCC/C1=C\CCC |
| InChI | InChI=1S/C13H22/c1-3-5-8-12-10-7-11-13(12)9-6-4-2/h8-9H,3-7,10-11H2,1-2H3/b12-8-,13-9+ |
| InChIKey | CWURCUVJQJTVNJ-QRBCZBMESA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |