About (1Z,2E)-1,2-di(butylidene)cyclopentane
(1Z,2E)-1,2-di(butylidene)cyclopentane (PubChem CID 177483288) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is (1Z,2E)-1,2-di(butylidene)cyclopentane.
Molecular Properties
| Compound Name | (1Z,2E)-1,2-di(butylidene)cyclopentane |
| PubChem CID | 177483288 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | (1Z,2E)-1,2-di(butylidene)cyclopentane |
| SMILES | CCC/C=C1/CCC/C1=C\CCC |
| InChI | InChI=1S/C13H22/c1-3-5-8-12-10-7-11-13(12)9-6-4-2/h8-9H,3-7,10-11H2,1-2H3/b12-8-,13-9+ |
| InChIKey | CWURCUVJQJTVNJ-QRBCZBMESA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1Z,2E)-1,2-di(butylidene)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,2E)-1,2-di(butylidene)cyclopentane?
The IUPAC name of (1Z,2E)-1,2-di(butylidene)cyclopentane (CID 177483288) is (1Z,2E)-1,2-di(butylidene)cyclopentane.
What is the SMILES notation for (1Z,2E)-1,2-di(butylidene)cyclopentane?
The canonical SMILES for (1Z,2E)-1,2-di(butylidene)cyclopentane is CCC/C=C1/CCC/C1=C\CCC.
What is the InChIKey of (1Z,2E)-1,2-di(butylidene)cyclopentane?
The InChIKey is CWURCUVJQJTVNJ-QRBCZBMESA-N. The full InChI is InChI=1S/C13H22/c1-3-5-8-12-10-7-11-13(12)9-6-4-2/h8-9H,3-7,10-11H2,1-2H3/b12-8-,13-9+.
What are the key properties of (1Z,2E)-1,2-di(butylidene)cyclopentane?
(1Z,2E)-1,2-di(butylidene)cyclopentane has a molecular weight of 178.32 g/mol, XLogP of 4.62, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,2E)-1,2-di(butylidene)cyclopentane is sourced from PubChem (CID 177483288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).