About S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate
S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate (PubChem CID 177483407) has the molecular formula C25H21NO5S
and a molecular weight of 447.51 g/mol. Its IUPAC name is S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate.
Molecular Properties
| Compound Name | S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate |
| PubChem CID | 177483407 |
| Molecular Formula | C25H21NO5S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate |
| SMILES | COCO[C@H](c1ccccc1)C(C(=O)Sc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C25H21NO5S/c1-30-16-31-22(17-10-4-2-5-11-17)21(25(29)32-18-12-6-3-7-13-18)26-23(27)19-14-8-9-15-20(19)24(26)28/h2-15,21-22H,16H2,1H3/t21?,22-/m1/s1 |
| InChIKey | BXDXLSUVABWMSQ-FOIFJWKZSA-N |
| XLogP | 4.33 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate?
The IUPAC name of S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate (CID 177483407) is S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate.
What is the SMILES notation for S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate?
The canonical SMILES for S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate is COCO[C@H](c1ccccc1)C(C(=O)Sc1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate?
The InChIKey is BXDXLSUVABWMSQ-FOIFJWKZSA-N. The full InChI is InChI=1S/C25H21NO5S/c1-30-16-31-22(17-10-4-2-5-11-17)21(25(29)32-18-12-6-3-7-13-18)26-23(27)19-14-8-9-15-20(19)24(26)28/h2-15,21-22H,16H2,1H3/t21?,22-/m1/s1.
What are the key properties of S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate?
S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate has a molecular weight of 447.51 g/mol, XLogP of 4.33, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-phenyl (3R)-2-(1,3-dioxoisoindol-2-yl)-3-(methoxymethoxy)-3-phenylpropanethioate is sourced from PubChem (CID 177483407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).