C25H32N2O4 — CID 177483934
diethyl 2-[(7E)-7-(2-phenylaziridin-1-yl)iminohepta-2,3-dienyl]-2-prop-2-enylpropanedioate (PubChem CID 177483934) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is diethyl 2-[(7E)-7-(2-phenylaziridin-1-yl)iminohepta-2,3-dienyl]-2-prop-2-enylpropanedioate.
| Compound Name | diethyl 2-[(7E)-7-(2-phenylaziridin-1-yl)iminohepta-2,3-dienyl]-2-prop-2-enylpropanedioate |
|---|---|
| PubChem CID | 177483934 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | diethyl 2-[(7E)-7-(2-phenylaziridin-1-yl)iminohepta-2,3-dienyl]-2-prop-2-enylpropanedioate |
| SMILES | C=CCC(CC=C=CCC/C=N/N1CC1c1ccccc1)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H32N2O4/c1-4-17-25(23(28)30-5-2,24(29)31-6-3)18-13-8-7-9-14-19-26-27-20-22(27)21-15-11-10-12-16-21/h4,7,10-13,15-16,19,22H,1,5-6,9,14,17-18,20H2,2-3H3/b26-19+ |
| InChIKey | OHFRPGMLBWRARD-LGUFXXKBSA-N |
| XLogP | 4.60 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|