C15H24Si — CID 177484089
trimethyl(3-tetracyclo[6.3.0.02,4.03,7]undec-5-enylmethyl)silane (PubChem CID 177484089) has the molecular formula C15H24Si and a molecular weight of 232.44 g/mol. Its IUPAC name is trimethyl(3-tetracyclo[6.3.0.02,4.03,7]undec-5-enylmethyl)silane.
| Compound Name | trimethyl(3-tetracyclo[6.3.0.02,4.03,7]undec-5-enylmethyl)silane |
|---|---|
| PubChem CID | 177484089 |
| Molecular Formula | C15H24Si |
| Molecular Weight | 232.44 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | trimethyl(3-tetracyclo[6.3.0.02,4.03,7]undec-5-enylmethyl)silane |
| SMILES | C[Si](C)(C)C[C@]12C3C=CC1C2C1CCCC13 |
| InChI | InChI=1S/C15H24Si/c1-16(2,3)9-15-12-7-8-13(15)14(15)11-6-4-5-10(11)12/h7-8,10-14H,4-6,9H2,1-3H3/t10?,11?,12?,13?,14?,15-/m0/s1 |
| InChIKey | ULHOGUPORPCMSH-FFSGTFEZSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|