C21H23ClN2O2S — CID 177484671
(1R,9R)-16-(4-chlorophenyl)sulfonyl-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene (PubChem CID 177484671) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is (1R,9R)-16-(4-chlorophenyl)sulfonyl-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene.
| Compound Name | (1R,9R)-16-(4-chlorophenyl)sulfonyl-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 177484671 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (1R,9R)-16-(4-chlorophenyl)sulfonyl-8-methyl-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene |
| SMILES | CN1c2ccccc2[C@]23CCCC[C@]12N(S(=O)(=O)c1ccc(Cl)cc1)CC3 |
| InChI | InChI=1S/C21H23ClN2O2S/c1-23-19-7-3-2-6-18(19)20-12-4-5-13-21(20,23)24(15-14-20)27(25,26)17-10-8-16(22)9-11-17/h2-3,6-11H,4-5,12-15H2,1H3/t20-,21-/m1/s1 |
| InChIKey | AAMRKPMJZIQWBU-NHCUHLMSSA-N |
| XLogP | 4.39 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |