C45H27F9 — CID 177484765
1,3,5-tris(4-phenylphenyl)-2,4,6-tris(trifluoromethyl)benzene (PubChem CID 177484765) has the molecular formula C45H27F9 and a molecular weight of 738.69 g/mol. Its IUPAC name is 1,3,5-tris(4-phenylphenyl)-2,4,6-tris(trifluoromethyl)benzene.
| Compound Name | 1,3,5-tris(4-phenylphenyl)-2,4,6-tris(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 177484765 |
| Molecular Formula | C45H27F9 |
| Molecular Weight | 738.69 g/mol |
| Exact Mass | 738.20 |
| IUPAC Name | 1,3,5-tris(4-phenylphenyl)-2,4,6-tris(trifluoromethyl)benzene |
| SMILES | FC(F)(F)c1c(-c2ccc(-c3ccccc3)cc2)c(C(F)(F)F)c(-c2ccc(-c3ccccc3)cc2)c(C(F)(F)F)c1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H27F9/c46-43(47,48)40-37(34-22-16-31(17-23-34)28-10-4-1-5-11-28)41(44(49,50)51)39(36-26-20-33(21-27-36)30-14-8-3-9-15-30)42(45(52,53)54)38(40)35-24-18-32(19-25-35)29-12-6-2-7-13-29/h1-27H |
| InChIKey | VSABTOQUQCYKSI-UHFFFAOYSA-N |
| XLogP | 14.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.69 |
| LogP ≤ 5 | 14.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |