C19H26ClN3O2S2 — CID 177484844
2-(benzylamino)-N'-(5-chlorothiophen-2-yl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide (PubChem CID 177484844) has the molecular formula C19H26ClN3O2S2 and a molecular weight of 428.02 g/mol. Its IUPAC name is 2-(benzylamino)-N'-(5-chlorothiophen-2-yl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide.
| Compound Name | 2-(benzylamino)-N'-(5-chlorothiophen-2-yl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 177484844 |
| Molecular Formula | C19H26ClN3O2S2 |
| Molecular Weight | 428.02 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | 2-(benzylamino)-N'-(5-chlorothiophen-2-yl)sulfonyl-N,N-di(propan-2-yl)ethanimidamide |
| SMILES | CC(C)N(/C(CNCc1ccccc1)=N/S(=O)(=O)c1ccc(Cl)s1)C(C)C |
| InChI | InChI=1S/C19H26ClN3O2S2/c1-14(2)23(15(3)4)18(13-21-12-16-8-6-5-7-9-16)22-27(24,25)19-11-10-17(20)26-19/h5-11,14-15,21H,12-13H2,1-4H3/b22-18+ |
| InChIKey | LFDKEHFWNFUNJT-RELWKKBWSA-N |
| XLogP | 4.40 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.02 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|