C14H20O3 — CID 177485300
(1S,2R,4S,7R,8R,9R,11S)-3,9,11-trimethoxytetracyclo[6.3.0.02,4.03,7]undec-5-ene (PubChem CID 177485300) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,2R,4S,7R,8R,9R,11S)-3,9,11-trimethoxytetracyclo[6.3.0.02,4.03,7]undec-5-ene.
| Compound Name | (1S,2R,4S,7R,8R,9R,11S)-3,9,11-trimethoxytetracyclo[6.3.0.02,4.03,7]undec-5-ene |
|---|---|
| PubChem CID | 177485300 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,2R,4S,7R,8R,9R,11S)-3,9,11-trimethoxytetracyclo[6.3.0.02,4.03,7]undec-5-ene |
| SMILES | CO[C@H]1C[C@@H](OC)[C@@H]2[C@H]1[C@@H]1[C@@H]3C=C[C@H]2[C@@]13OC |
| InChI | InChI=1S/C14H20O3/c1-15-9-6-10(16-2)12-11(9)7-4-5-8-13(12)14(7,8)17-3/h4-5,7-13H,6H2,1-3H3/t7-,8+,9-,10+,11-,12+,13+,14+/m1/s1 |
| InChIKey | DJLQGOZZWIEVRY-MJFRGSRISA-N |
| XLogP | 1.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|