C28H23N3OS2 — CID 177485361
methyl 4-anilino-5-benzoyl-3-cyano-N-(2,6-dimethylphenyl)thiophene-2-carboximidothioate (PubChem CID 177485361) has the molecular formula C28H23N3OS2 and a molecular weight of 481.65 g/mol. Its IUPAC name is methyl 4-anilino-5-benzoyl-3-cyano-N-(2,6-dimethylphenyl)thiophene-2-carboximidothioate.
| Compound Name | methyl 4-anilino-5-benzoyl-3-cyano-N-(2,6-dimethylphenyl)thiophene-2-carboximidothioate |
|---|---|
| PubChem CID | 177485361 |
| Molecular Formula | C28H23N3OS2 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | methyl 4-anilino-5-benzoyl-3-cyano-N-(2,6-dimethylphenyl)thiophene-2-carboximidothioate |
| SMILES | CS/C(=N\c1c(C)cccc1C)c1sc(C(=O)c2ccccc2)c(Nc2ccccc2)c1C#N |
| InChI | InChI=1S/C28H23N3OS2/c1-18-11-10-12-19(2)23(18)31-28(33-3)26-22(17-29)24(30-21-15-8-5-9-16-21)27(34-26)25(32)20-13-6-4-7-14-20/h4-16,30H,1-3H3/b31-28- |
| InChIKey | KCNLBJQUJZGNDW-PNOGMODKSA-N |
| XLogP | 7.65 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|