About 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one
6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one (PubChem CID 177485750) has the molecular formula C12H14FNO
and a molecular weight of 207.25 g/mol. Its IUPAC name is 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one |
| PubChem CID | 177485750 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one |
| SMILES | CN1CC(C)(C)c2cc(F)ccc2C1=O |
| InChI | InChI=1S/C12H14FNO/c1-12(2)7-14(3)11(15)9-5-4-8(13)6-10(9)12/h4-6H,7H2,1-3H3 |
| InChIKey | HBJJYPZDAYQPJT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one?
The IUPAC name of 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one (CID 177485750) is 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one.
What is the SMILES notation for 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one?
The canonical SMILES for 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one is CN1CC(C)(C)c2cc(F)ccc2C1=O.
What is the InChIKey of 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one?
The InChIKey is HBJJYPZDAYQPJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO/c1-12(2)7-14(3)11(15)9-5-4-8(13)6-10(9)12/h4-6H,7H2,1-3H3.
What are the key properties of 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one?
6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one has a molecular weight of 207.25 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,4,4-trimethyl-3H-isoquinolin-1-one is sourced from PubChem (CID 177485750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).