C21H23IN2 — CID 177485940
(2Z)-2-[(4-iodophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-3,4,5-trimethylpyrrole (PubChem CID 177485940) has the molecular formula C21H23IN2 and a molecular weight of 430.33 g/mol. Its IUPAC name is (2Z)-2-[(4-iodophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-3,4,5-trimethylpyrrole.
| Compound Name | (2Z)-2-[(4-iodophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-3,4,5-trimethylpyrrole |
|---|---|
| PubChem CID | 177485940 |
| Molecular Formula | C21H23IN2 |
| Molecular Weight | 430.33 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | (2Z)-2-[(4-iodophenyl)-(3,4,5-trimethyl-1H-pyrrol-2-yl)methylidene]-3,4,5-trimethylpyrrole |
| SMILES | CC1=N/C(=C(/c2ccc(I)cc2)c2[nH]c(C)c(C)c2C)C(C)=C1C |
| InChI | InChI=1S/C21H23IN2/c1-11-13(3)20(23-15(11)5)19(17-7-9-18(22)10-8-17)21-14(4)12(2)16(6)24-21/h7-10,23H,1-6H3/b21-19- |
| InChIKey | SRQKDZVOOKQDMI-VZCXRCSSSA-N |
| XLogP | 6.11 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.33 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|