C20H32O2 — CID 177486035
(1S,3E,7E,11S,12S,14R)-3,7,11-trimethyl-14-prop-1-en-2-yl-15-oxabicyclo[9.3.1]pentadeca-3,7-dien-12-ol (PubChem CID 177486035) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,3E,7E,11S,12S,14R)-3,7,11-trimethyl-14-prop-1-en-2-yl-15-oxabicyclo[9.3.1]pentadeca-3,7-dien-12-ol.
| Compound Name | (1S,3E,7E,11S,12S,14R)-3,7,11-trimethyl-14-prop-1-en-2-yl-15-oxabicyclo[9.3.1]pentadeca-3,7-dien-12-ol |
|---|---|
| PubChem CID | 177486035 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,3E,7E,11S,12S,14R)-3,7,11-trimethyl-14-prop-1-en-2-yl-15-oxabicyclo[9.3.1]pentadeca-3,7-dien-12-ol |
| SMILES | C=C(C)[C@H]1C[C@H](O)[C@]2(C)CC/C=C(\C)CC/C=C(\C)C[C@@H]1O2 |
| InChI | InChI=1S/C20H32O2/c1-14(2)17-13-19(21)20(5)11-7-10-15(3)8-6-9-16(4)12-18(17)22-20/h9-10,17-19,21H,1,6-8,11-13H2,2-5H3/b15-10+,16-9+/t17-,18+,19+,20+/m1/s1 |
| InChIKey | FNARXCUDRWIIRC-SRLITVLVSA-N |
| XLogP | 4.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|