C26H34O5 — CID 177487717
(1S,11S)-5,5'-dihydroxy-5,7,11-trimethylspiro[13-oxatetracyclo[9.3.3.01,10.02,7]heptadecane-6,2'-3H-1-benzofuran]-12-one (PubChem CID 177487717) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is (1S,11S)-5,5'-dihydroxy-5,7,11-trimethylspiro[13-oxatetracyclo[9.3.3.01,10.02,7]heptadecane-6,2'-3H-1-benzofuran]-12-one.
| Compound Name | (1S,11S)-5,5'-dihydroxy-5,7,11-trimethylspiro[13-oxatetracyclo[9.3.3.01,10.02,7]heptadecane-6,2'-3H-1-benzofuran]-12-one |
|---|---|
| PubChem CID | 177487717 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | (1S,11S)-5,5'-dihydroxy-5,7,11-trimethylspiro[13-oxatetracyclo[9.3.3.01,10.02,7]heptadecane-6,2'-3H-1-benzofuran]-12-one |
| SMILES | CC1(O)CCC2C(C)(CCC3[C@]24CCC[C@]3(C)C(=O)OC4)C12Cc1cc(O)ccc1O2 |
| InChI | InChI=1S/C26H34O5/c1-22-9-4-10-25(15-30-21(22)28)19(22)7-11-23(2)20(25)8-12-24(3,29)26(23)14-16-13-17(27)5-6-18(16)31-26/h5-6,13,19-20,27,29H,4,7-12,14-15H2,1-3H3/t19?,20?,22-,23?,24?,25+,26?/m0/s1 |
| InChIKey | IJTRNQBAOLWHPO-MKLRFAPJSA-N |
| XLogP | 4.38 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |