C13H15NO2 — CID 177487888
(1S,3R,6S,7R,8S)-1,3-dimethyl-2,5-dioxotricyclo[4.3.1.03,7]decane-8-carbonitrile (PubChem CID 177487888) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (1S,3R,6S,7R,8S)-1,3-dimethyl-2,5-dioxotricyclo[4.3.1.03,7]decane-8-carbonitrile.
| Compound Name | (1S,3R,6S,7R,8S)-1,3-dimethyl-2,5-dioxotricyclo[4.3.1.03,7]decane-8-carbonitrile |
|---|---|
| PubChem CID | 177487888 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1S,3R,6S,7R,8S)-1,3-dimethyl-2,5-dioxotricyclo[4.3.1.03,7]decane-8-carbonitrile |
| SMILES | C[C@]12C[C@@H]3C(=O)C[C@@](C)(C1=O)[C@@H]3[C@@H](C#N)C2 |
| InChI | InChI=1S/C13H15NO2/c1-12-3-7(6-14)10-8(4-12)9(15)5-13(10,2)11(12)16/h7-8,10H,3-5H2,1-2H3/t7-,8-,10-,12+,13-/m1/s1 |
| InChIKey | GICJIEPQSGMZQD-QLSGDXETSA-N |
| XLogP | 1.72 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |