C30H39BN2O — CID 177487981
triethyl-[1-(2-naphthalen-1-yl-2-oxoethyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]boranuide (PubChem CID 177487981) has the molecular formula C30H39BN2O and a molecular weight of 454.47 g/mol. Its IUPAC name is triethyl-[1-(2-naphthalen-1-yl-2-oxoethyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]boranuide.
| Compound Name | triethyl-[1-(2-naphthalen-1-yl-2-oxoethyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]boranuide |
|---|---|
| PubChem CID | 177487981 |
| Molecular Formula | C30H39BN2O |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | triethyl-[1-(2-naphthalen-1-yl-2-oxoethyl)-3-(2,4,6-trimethylphenyl)-4,5-dihydroimidazol-1-ium-2-yl]boranuide |
| SMILES | CC[B-](CC)(CC)C1=[N+](CC(=O)c2cccc3ccccc23)CCN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C30H39BN2O/c1-7-31(8-2,9-3)30-32(17-18-33(30)29-23(5)19-22(4)20-24(29)6)21-28(34)27-16-12-14-25-13-10-11-15-26(25)27/h10-16,19-20H,7-9,17-18,21H2,1-6H3 |
| InChIKey | MMMOLDJALNGLHJ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|