About (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine
(E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine (PubChem CID 177489873) has the molecular formula C21H18N4OS
and a molecular weight of 374.47 g/mol. Its IUPAC name is (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine.
Molecular Properties
| Compound Name | (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine |
| PubChem CID | 177489873 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine |
| SMILES | C/C(=N\N=c1\sc(Cc2ccco2)nn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H18N4OS/c1-16(17-9-4-2-5-10-17)22-23-21-25(18-11-6-3-7-12-18)24-20(27-21)15-19-13-8-14-26-19/h2-14H,15H2,1H3/b22-16+,23-21+ |
| InChIKey | KXDQUHWSAWRUBW-ZVGWPXEBSA-N |
| XLogP | 4.44 |
| TPSA | 55.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine?
The IUPAC name of (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine (CID 177489873) is (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine.
What is the SMILES notation for (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine?
The canonical SMILES for (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine is C/C(=N\N=c1\sc(Cc2ccco2)nn1-c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine?
The InChIKey is KXDQUHWSAWRUBW-ZVGWPXEBSA-N. The full InChI is InChI=1S/C21H18N4OS/c1-16(17-9-4-2-5-10-17)22-23-21-25(18-11-6-3-7-12-18)24-20(27-21)15-19-13-8-14-26-19/h2-14H,15H2,1H3/b22-16+,23-21+.
What are the key properties of (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine?
(E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine has a molecular weight of 374.47 g/mol, XLogP of 4.44, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-(furan-2-ylmethyl)-3-phenyl-N-[(E)-1-phenylethylideneamino]-1,3,4-thiadiazol-2-imine is sourced from PubChem (CID 177489873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).