C43H36N4O4 — CID 177490148
6-(2,5-ditert-butylphenyl)-13-[4-[(E)-1H-pyrrol-2-yl(pyrrol-2-ylidene)methyl]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 177490148) has the molecular formula C43H36N4O4 and a molecular weight of 672.79 g/mol. Its IUPAC name is 6-(2,5-ditert-butylphenyl)-13-[4-[(E)-1H-pyrrol-2-yl(pyrrol-2-ylidene)methyl]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6-(2,5-ditert-butylphenyl)-13-[4-[(E)-1H-pyrrol-2-yl(pyrrol-2-ylidene)methyl]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 177490148 |
| Molecular Formula | C43H36N4O4 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | 6-(2,5-ditert-butylphenyl)-13-[4-[(E)-1H-pyrrol-2-yl(pyrrol-2-ylidene)methyl]phenyl]-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CC(C)(C)c1ccc(C(C)(C)C)c(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(/C(=C3/C=CC=N3)c3ccc[nH]3)cc2)C4=O)c1 |
| InChI | InChI=1S/C43H36N4O4/c1-42(2,3)25-13-20-31(43(4,5)6)34(23-25)47-40(50)29-18-16-27-36-28(17-19-30(37(29)36)41(47)51)39(49)46(38(27)48)26-14-11-24(12-15-26)35(32-9-7-21-44-32)33-10-8-22-45-33/h7-23,44H,1-6H3/b35-33+ |
| InChIKey | YCLKXSNTRXKUQA-LAPDZXRHSA-N |
| XLogP | 8.76 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|