C74H60N8O4 — CID 177490313
2-(5-methyl-2-pyridinyl)-5-[[4-[1,2,2-tris[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethenyl]phenoxy]methyl]pyridine (PubChem CID 177490313) has the molecular formula C74H60N8O4 and a molecular weight of 1125.35 g/mol. Its IUPAC name is 2-(5-methyl-2-pyridinyl)-5-[[4-[1,2,2-tris[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethenyl]phenoxy]methyl]pyridine.
| Compound Name | 2-(5-methyl-2-pyridinyl)-5-[[4-[1,2,2-tris[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethenyl]phenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 177490313 |
| Molecular Formula | C74H60N8O4 |
| Molecular Weight | 1125.35 g/mol |
| Exact Mass | 1124.47 |
| IUPAC Name | 2-(5-methyl-2-pyridinyl)-5-[[4-[1,2,2-tris[4-[[6-(5-methyl-2-pyridinyl)-3-pyridinyl]methoxy]phenyl]ethenyl]phenoxy]methyl]pyridine |
| SMILES | Cc1ccc(-c2ccc(COc3ccc(C(=C(c4ccc(OCc5ccc(-c6ccc(C)cn6)nc5)cc4)c4ccc(OCc5ccc(-c6ccc(C)cn6)nc5)cc4)c4ccc(OCc5ccc(-c6ccc(C)cn6)nc5)cc4)cc3)cn2)nc1 |
| InChI | InChI=1S/C74H60N8O4/c1-49-5-29-65(75-37-49)69-33-9-53(41-79-69)45-83-61-21-13-57(14-22-61)73(58-15-23-62(24-16-58)84-46-54-10-34-70(80-42-54)66-30-6-50(2)38-76-66)74(59-17-25-63(26-18-59)85-47-55-11-35-71(81-43-55)67-31-7-51(3)39-77-67)60-19-27-64(28-20-60)86-48-56-12-36-72(82-44-56)68-32-8-52(4)40-78-68/h5-44H,45-48H2,1-4H3 |
| InChIKey | GYIDIWOJQNVUTJ-UHFFFAOYSA-N |
| XLogP | 16.07 |
| TPSA | 140.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 86 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.35 |
| LogP ≤ 5 | 16.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|