C36H42Cl2N4O4S — CID 177490594
N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-4-(dimethylamino)-N-methylnaphthalene-1-sulfonamide (PubChem CID 177490594) has the molecular formula C36H42Cl2N4O4S and a molecular weight of 697.73 g/mol. Its IUPAC name is N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-4-(dimethylamino)-N-methylnaphthalene-1-sulfonamide.
| Compound Name | N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-4-(dimethylamino)-N-methylnaphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 177490594 |
| Molecular Formula | C36H42Cl2N4O4S |
| Molecular Weight | 697.73 g/mol |
| Exact Mass | 696.23 |
| IUPAC Name | N-[(2E)-3-(3,4-dichlorophenyl)-5-(4-hydroxy-4-phenylpiperidin-1-yl)-2-methoxyiminopentyl]-4-(dimethylamino)-N-methylnaphthalene-1-sulfonamide |
| SMILES | CO/N=C(/CN(C)S(=O)(=O)c1ccc(N(C)C)c2ccccc12)C(CCN1CCC(O)(c2ccccc2)CC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C36H42Cl2N4O4S/c1-40(2)34-16-17-35(30-13-9-8-12-29(30)34)47(44,45)41(3)25-33(39-46-4)28(26-14-15-31(37)32(38)24-26)18-21-42-22-19-36(43,20-23-42)27-10-6-5-7-11-27/h5-17,24,28,43H,18-23,25H2,1-4H3/b39-33- |
| InChIKey | BUBSYEDWGKJXQZ-SCURRHDHSA-N |
| XLogP | 6.99 |
| TPSA | 85.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.73 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|