C18H23N3O — CID 177491317
N-(diaminomethylidene)-4-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide (PubChem CID 177491317) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(diaminomethylidene)-4-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide.
| Compound Name | N-(diaminomethylidene)-4-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide |
|---|---|
| PubChem CID | 177491317 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-(diaminomethylidene)-4-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)methyl]benzamide |
| SMILES | CC1=C/C(=C/c2ccc(C(=O)N=C(N)N)cc2)CC(C)(C)C1 |
| InChI | InChI=1S/C18H23N3O/c1-12-8-14(11-18(2,3)10-12)9-13-4-6-15(7-5-13)16(22)21-17(19)20/h4-9H,10-11H2,1-3H3,(H4,19,20,21,22)/b14-9- |
| InChIKey | JXPIZPDWVRIKGZ-ZROIWOOFSA-N |
| XLogP | 3.25 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|