C28H40N2O9S — CID 177491536
(1S,14S,16R)-16-methoxy-16-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-10-propan-2-yl-2,7,12,15-tetraoxa-9-azabicyclo[12.3.1]octadecane-8,11-dione (PubChem CID 177491536) has the molecular formula C28H40N2O9S and a molecular weight of 580.70 g/mol. Its IUPAC name is (1S,14S,16R)-16-methoxy-16-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-10-propan-2-yl-2,7,12,15-tetraoxa-9-azabicyclo[12.3.1]octadecane-8,11-dione.
| Compound Name | (1S,14S,16R)-16-methoxy-16-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-10-propan-2-yl-2,7,12,15-tetraoxa-9-azabicyclo[12.3.1]octadecane-8,11-dione |
|---|---|
| PubChem CID | 177491536 |
| Molecular Formula | C28H40N2O9S |
| Molecular Weight | 580.70 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | (1S,14S,16R)-16-methoxy-16-[(4R)-3-[(4-methoxyphenyl)methyl]-2-oxo-1,3-thiazolidin-4-yl]-10-propan-2-yl-2,7,12,15-tetraoxa-9-azabicyclo[12.3.1]octadecane-8,11-dione |
| SMILES | COc1ccc(CN2C(=O)SC[C@H]2[C@@]2(OC)C[C@@H]3C[C@@H](COC(=O)C(C(C)C)NC(=O)OCCCCO3)O2)cc1 |
| InChI | InChI=1S/C28H40N2O9S/c1-18(2)24-25(31)38-16-22-13-21(36-11-5-6-12-37-26(32)29-24)14-28(35-4,39-22)23-17-40-27(33)30(23)15-19-7-9-20(34-3)10-8-19/h7-10,18,21-24H,5-6,11-17H2,1-4H3,(H,29,32)/t21-,22-,23-,24?,28+/m0/s1 |
| InChIKey | YHKPWPLVEAYUQK-HNTJBFKQSA-N |
| XLogP | 3.73 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|