About (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one
(E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one (PubChem CID 177492356) has the molecular formula C28H22O
and a molecular weight of 374.48 g/mol. Its IUPAC name is (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one |
| PubChem CID | 177492356 |
| Molecular Formula | C28H22O |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one |
| SMILES | C/C(=C\C(=O)c1ccc2c3c(cccc13)CC2)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C28H22O/c1-17(22-14-12-20-10-8-18-4-2-6-24(22)27(18)20)16-26(29)23-15-13-21-11-9-19-5-3-7-25(23)28(19)21/h2-7,12-16H,8-11H2,1H3/b17-16+ |
| InChIKey | CPRNYBAUTOKKFX-WUKNDPDISA-N |
| XLogP | 6.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one?
The IUPAC name of (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one (CID 177492356) is (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one.
What is the SMILES notation for (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one?
The canonical SMILES for (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one is C/C(=C\C(=O)c1ccc2c3c(cccc13)CC2)c1ccc2c3c(cccc13)CC2.
What is the InChIKey of (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one?
The InChIKey is CPRNYBAUTOKKFX-WUKNDPDISA-N. The full InChI is InChI=1S/C28H22O/c1-17(22-14-12-20-10-8-18-4-2-6-24(22)27(18)20)16-26(29)23-15-13-21-11-9-19-5-3-7-25(23)28(19)21/h2-7,12-16H,8-11H2,1H3/b17-16+.
What are the key properties of (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one?
(E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one has a molecular weight of 374.48 g/mol, XLogP of 6.48, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,3-bis(1,2-dihydroacenaphthylen-5-yl)but-2-en-1-one is sourced from PubChem (CID 177492356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).