C30H31N3 — CID 177492824
N-[(1R,2S)-1,2-diphenyl-2-piperidin-1-ylethyl]-4-pyridin-4-ylaniline (PubChem CID 177492824) has the molecular formula C30H31N3 and a molecular weight of 433.60 g/mol. Its IUPAC name is N-[(1R,2S)-1,2-diphenyl-2-piperidin-1-ylethyl]-4-pyridin-4-ylaniline.
| Compound Name | N-[(1R,2S)-1,2-diphenyl-2-piperidin-1-ylethyl]-4-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 177492824 |
| Molecular Formula | C30H31N3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-[(1R,2S)-1,2-diphenyl-2-piperidin-1-ylethyl]-4-pyridin-4-ylaniline |
| SMILES | c1ccc([C@@H](Nc2ccc(-c3ccncc3)cc2)[C@H](c2ccccc2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C30H31N3/c1-4-10-26(11-5-1)29(30(27-12-6-2-7-13-27)33-22-8-3-9-23-33)32-28-16-14-24(15-17-28)25-18-20-31-21-19-25/h1-2,4-7,10-21,29-30,32H,3,8-9,22-23H2/t29-,30+/m1/s1 |
| InChIKey | JMCXIUGPDBALIM-IHLOFXLRSA-N |
| XLogP | 7.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |