C31H33BrN2O7 — CID 177493399
tert-butyl (2'S,3R,3'S,5'S)-5'-(5-bromofuran-2-yl)-3'-[4-(4-methoxy-4-oxobutoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate (PubChem CID 177493399) has the molecular formula C31H33BrN2O7 and a molecular weight of 625.52 g/mol. Its IUPAC name is tert-butyl (2'S,3R,3'S,5'S)-5'-(5-bromofuran-2-yl)-3'-[4-(4-methoxy-4-oxobutoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate.
| Compound Name | tert-butyl (2'S,3R,3'S,5'S)-5'-(5-bromofuran-2-yl)-3'-[4-(4-methoxy-4-oxobutoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
|---|---|
| PubChem CID | 177493399 |
| Molecular Formula | C31H33BrN2O7 |
| Molecular Weight | 625.52 g/mol |
| Exact Mass | 624.15 |
| IUPAC Name | tert-butyl (2'S,3R,3'S,5'S)-5'-(5-bromofuran-2-yl)-3'-[4-(4-methoxy-4-oxobutoxy)phenyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxylate |
| SMILES | COC(=O)CCCOc1ccc([C@@H]2[C@@H](C(=O)OC(C)(C)C)N[C@H](c3ccc(Br)o3)[C@@]23C(=O)Nc2ccccc23)cc1 |
| InChI | InChI=1S/C31H33BrN2O7/c1-30(2,3)41-28(36)26-25(18-11-13-19(14-12-18)39-17-7-10-24(35)38-4)31(27(34-26)22-15-16-23(32)40-22)20-8-5-6-9-21(20)33-29(31)37/h5-6,8-9,11-16,25-27,34H,7,10,17H2,1-4H3,(H,33,37)/t25-,26+,27-,31+/m1/s1 |
| InChIKey | LELKPJUGUNPRGM-LIGWSQQPSA-N |
| XLogP | 5.40 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|