C19H24O4 — CID 177493718
ethyl (1R,2S)-3a-hydroxy-7a-methyl-3-oxo-1-phenyl-1,2,4,5,6,7-hexahydroindene-2-carboxylate (PubChem CID 177493718) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is ethyl (1R,2S)-3a-hydroxy-7a-methyl-3-oxo-1-phenyl-1,2,4,5,6,7-hexahydroindene-2-carboxylate.
| Compound Name | ethyl (1R,2S)-3a-hydroxy-7a-methyl-3-oxo-1-phenyl-1,2,4,5,6,7-hexahydroindene-2-carboxylate |
|---|---|
| PubChem CID | 177493718 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | ethyl (1R,2S)-3a-hydroxy-7a-methyl-3-oxo-1-phenyl-1,2,4,5,6,7-hexahydroindene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C2(O)CCCCC2(C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H24O4/c1-3-23-17(21)14-15(13-9-5-4-6-10-13)18(2)11-7-8-12-19(18,22)16(14)20/h4-6,9-10,14-15,22H,3,7-8,11-12H2,1-2H3/t14-,15-,18?,19?/m0/s1 |
| InChIKey | AZLWRAVBXXAHHU-GKVPXEHWSA-N |
| XLogP | 2.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|