About CID 177494305
CID 177494305 (PubChem CID 177494305) has the molecular formula C50H50N10O4Si
and a molecular weight of 883.10 g/mol.
Molecular Properties
| Compound Name | CID 177494305 |
| PubChem CID | 177494305 |
| Molecular Formula | C50H50N10O4Si |
| Molecular Weight | 883.10 g/mol |
| Exact Mass | 882.38 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(O[Si]2(OC3CC(C)(C)N([O])C(C)(C)C3)n3c4c5ccccc5c3/N=C3\N=C(/N=c5/c6ccccc6/c(n52)=N/C2=N/C(=N\4)c4ccccc42)c2ccccc23)CC(C)(C)N1[O] |
| InChI | InChI=1S/C50H50N10O4Si/c1-47(2)25-29(26-48(3,4)59(47)61)63-65(64-30-27-49(5,6)60(62)50(7,8)28-30)57-43-35-21-13-14-22-36(35)45(57)55-41-33-19-11-12-20-34(33)42(52-41)56-46-38-24-16-15-23-37(38)44(58(46)65)54-40-32-18-10-9-17-31(32)39(51-40)53-43/h9-24,29-30H,25-28H2,1-8H3/b53-39-,53-43-,54-40-,54-44-,55-41-,55-45-,56-42-,56-46- |
| InChIKey | DLSGZBRVGPBMDV-HZTXYMAMSA-N |
| XLogP | 8.14 |
| TPSA | 148.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 65 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 883.10 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 177494305 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177494305?
The IUPAC name of CID 177494305 (CID 177494305) is not available.
What is the SMILES notation for CID 177494305?
The canonical SMILES for CID 177494305 is CC1(C)CC(O[Si]2(OC3CC(C)(C)N([O])C(C)(C)C3)n3c4c5ccccc5c3/N=C3\N=C(/N=c5/c6ccccc6/c(n52)=N/C2=N/C(=N\4)c4ccccc42)c2ccccc23)CC(C)(C)N1[O].
What is the InChIKey of CID 177494305?
The InChIKey is DLSGZBRVGPBMDV-HZTXYMAMSA-N. The full InChI is InChI=1S/C50H50N10O4Si/c1-47(2)25-29(26-48(3,4)59(47)61)63-65(64-30-27-49(5,6)60(62)50(7,8)28-30)57-43-35-21-13-14-22-36(35)45(57)55-41-33-19-11-12-20-34(33)42(52-41)56-46-38-24-16-15-23-37(38)44(58(46)65)54-40-32-18-10-9-17-31(32)39(51-40)53-43/h9-24,29-30H,25-28H2,1-8H3/b53-39-,53-43-,54-40-,54-44-,55-41-,55-45-,56-42-,56-46-.
What are the key properties of CID 177494305?
CID 177494305 has a molecular weight of 883.10 g/mol, XLogP of 8.14, 4 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177494305 is sourced from PubChem (CID 177494305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).