C17H24N2O4 — CID 177494744
[(Z)-[1-(2-hydroxy-5-methylphenyl)-2-methyl-3-morpholin-4-ylpropylidene]amino] acetate (PubChem CID 177494744) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is [(Z)-[1-(2-hydroxy-5-methylphenyl)-2-methyl-3-morpholin-4-ylpropylidene]amino] acetate.
| Compound Name | [(Z)-[1-(2-hydroxy-5-methylphenyl)-2-methyl-3-morpholin-4-ylpropylidene]amino] acetate |
|---|---|
| PubChem CID | 177494744 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | [(Z)-[1-(2-hydroxy-5-methylphenyl)-2-methyl-3-morpholin-4-ylpropylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(\c1cc(C)ccc1O)C(C)CN1CCOCC1 |
| InChI | InChI=1S/C17H24N2O4/c1-12-4-5-16(21)15(10-12)17(18-23-14(3)20)13(2)11-19-6-8-22-9-7-19/h4-5,10,13,21H,6-9,11H2,1-3H3/b18-17- |
| InChIKey | MYPPMTOEILMSIT-ZCXUNETKSA-N |
| XLogP | 1.94 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|