C32H38N2O6 — CID 177495046
(1R,3R,4Z,8Z,15R,18R,19R,20S)-2,11-dihydroxy-18-(1H-indol-3-ylmethyl)-1,7,9,20-tetramethyl-21-oxa-17-azatetracyclo[16.2.1.03,15.015,19]henicosa-4,8-diene-10,14,16-trione (PubChem CID 177495046) has the molecular formula C32H38N2O6 and a molecular weight of 546.66 g/mol. Its IUPAC name is (1R,3R,4Z,8Z,15R,18R,19R,20S)-2,11-dihydroxy-18-(1H-indol-3-ylmethyl)-1,7,9,20-tetramethyl-21-oxa-17-azatetracyclo[16.2.1.03,15.015,19]henicosa-4,8-diene-10,14,16-trione.
| Compound Name | (1R,3R,4Z,8Z,15R,18R,19R,20S)-2,11-dihydroxy-18-(1H-indol-3-ylmethyl)-1,7,9,20-tetramethyl-21-oxa-17-azatetracyclo[16.2.1.03,15.015,19]henicosa-4,8-diene-10,14,16-trione |
|---|---|
| PubChem CID | 177495046 |
| Molecular Formula | C32H38N2O6 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (1R,3R,4Z,8Z,15R,18R,19R,20S)-2,11-dihydroxy-18-(1H-indol-3-ylmethyl)-1,7,9,20-tetramethyl-21-oxa-17-azatetracyclo[16.2.1.03,15.015,19]henicosa-4,8-diene-10,14,16-trione |
| SMILES | C/C1=C/C(C)C/C=C\[C@H]2C(O)[C@]3(C)O[C@@]4(Cc5c[nH]c6ccccc56)NC(=O)[C@@]2(C(=O)CCC(O)C1=O)[C@H]4[C@@H]3C |
| InChI | InChI=1S/C32H38N2O6/c1-17-8-7-10-22-28(38)30(4)19(3)27-31(40-30,15-20-16-33-23-11-6-5-9-21(20)23)34-29(39)32(22,27)25(36)13-12-24(35)26(37)18(2)14-17/h5-7,9-11,14,16-17,19,22,24,27-28,33,35,38H,8,12-13,15H2,1-4H3,(H,34,39)/b10-7-,18-14-/t17?,19-,22-,24?,27-,28?,30+,31+,32-/m0/s1 |
| InChIKey | CVOHSTWUORXTFP-VHKGAKQXSA-N |
| XLogP | 3.38 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|