C25H46O6 — CID 177495122
(3R,4S,5R,7S,9R,11R,13S,14R)-14-ethenyl-4,6,10,12-tetramethoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one (PubChem CID 177495122) has the molecular formula C25H46O6 and a molecular weight of 442.64 g/mol. Its IUPAC name is (3R,4S,5R,7S,9R,11R,13S,14R)-14-ethenyl-4,6,10,12-tetramethoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one.
| Compound Name | (3R,4S,5R,7S,9R,11R,13S,14R)-14-ethenyl-4,6,10,12-tetramethoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
|---|---|
| PubChem CID | 177495122 |
| Molecular Formula | C25H46O6 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | (3R,4S,5R,7S,9R,11R,13S,14R)-14-ethenyl-4,6,10,12-tetramethoxy-3,5,7,9,11,13-hexamethyl-oxacyclotetradecan-2-one |
| SMILES | C=C[C@H]1OC(=O)[C@H](C)[C@@H](OC)[C@H](C)C(OC)[C@@H](C)C[C@@H](C)C(OC)[C@@H](C)C(OC)[C@@H]1C |
| InChI | InChI=1S/C25H46O6/c1-12-20-16(4)23(29-10)17(5)21(27-8)14(2)13-15(3)22(28-9)18(6)24(30-11)19(7)25(26)31-20/h12,14-24H,1,13H2,2-11H3/t14-,15+,16-,17-,18-,19-,20-,21?,22?,23?,24+/m1/s1 |
| InChIKey | CHIIREVAMUAGTI-WIZDRFJOSA-N |
| XLogP | 4.36 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|