About CID 177495331
CID 177495331 (PubChem CID 177495331) has the molecular formula C26H10Cl6F2NS2
and a molecular weight of 651.22 g/mol.
Molecular Properties
| Compound Name | CID 177495331 |
| PubChem CID | 177495331 |
| Molecular Formula | C26H10Cl6F2NS2 |
| Molecular Weight | 651.22 g/mol |
| Exact Mass | 647.84 |
| IUPAC Name | — |
| SMILES | Fc1cncc(F)c1[C](c1c(Cl)cc(Cl)c(-c2cccs2)c1Cl)c1c(Cl)cc(Cl)c(-c2cccs2)c1Cl |
| InChI | InChI=1S/C26H10Cl6F2NS2/c27-11-7-13(29)21(25(31)19(11)17-3-1-5-36-17)24(23-15(33)9-35-10-16(23)34)22-14(30)8-12(28)20(26(22)32)18-4-2-6-37-18/h1-10H |
| InChIKey | XJJPTUFLTBQUSB-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 651.22 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 177495331 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 177495331?
The IUPAC name of CID 177495331 (CID 177495331) is not available.
What is the SMILES notation for CID 177495331?
The canonical SMILES for CID 177495331 is Fc1cncc(F)c1[C](c1c(Cl)cc(Cl)c(-c2cccs2)c1Cl)c1c(Cl)cc(Cl)c(-c2cccs2)c1Cl.
What is the InChIKey of CID 177495331?
The InChIKey is XJJPTUFLTBQUSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H10Cl6F2NS2/c27-11-7-13(29)21(25(31)19(11)17-3-1-5-36-17)24(23-15(33)9-35-10-16(23)34)22-14(30)8-12(28)20(26(22)32)18-4-2-6-37-18/h1-10H.
What are the key properties of CID 177495331?
CID 177495331 has a molecular weight of 651.22 g/mol, XLogP of 11.76, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 177495331 is sourced from PubChem (CID 177495331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).