About (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine
(NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine (PubChem CID 177495479) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine |
| PubChem CID | 177495479 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine |
| SMILES | COc1cc(OC)c2c(c1)C1(CCCCCC1)C/C2=N/O |
| InChI | InChI=1S/C17H23NO3/c1-20-12-9-13-16(15(10-12)21-2)14(18-19)11-17(13)7-5-3-4-6-8-17/h9-10,19H,3-8,11H2,1-2H3/b18-14- |
| InChIKey | AZUVVGFHPGPECZ-JXAWBTAJSA-N |
| XLogP | 3.88 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine?
The IUPAC name of (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine (CID 177495479) is (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine.
What is the SMILES notation for (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine?
The canonical SMILES for (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine is COc1cc(OC)c2c(c1)C1(CCCCCC1)C/C2=N/O.
What is the InChIKey of (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine?
The InChIKey is AZUVVGFHPGPECZ-JXAWBTAJSA-N. The full InChI is InChI=1S/C17H23NO3/c1-20-12-9-13-16(15(10-12)21-2)14(18-19)11-17(13)7-5-3-4-6-8-17/h9-10,19H,3-8,11H2,1-2H3/b18-14-.
What are the key properties of (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine?
(NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine has a molecular weight of 289.38 g/mol, XLogP of 3.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-(5,7-dimethoxyspiro[2H-indene-3,1'-cycloheptane]-1-ylidene)hydroxylamine is sourced from PubChem (CID 177495479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).