C46H42N8O3 — CID 177495540
2-[(E)-[8-[(1-benzyltriazol-4-yl)methoxy]quinolin-2-yl]methylideneamino]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one (PubChem CID 177495540) has the molecular formula C46H42N8O3 and a molecular weight of 754.90 g/mol. Its IUPAC name is 2-[(E)-[8-[(1-benzyltriazol-4-yl)methoxy]quinolin-2-yl]methylideneamino]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one.
| Compound Name | 2-[(E)-[8-[(1-benzyltriazol-4-yl)methoxy]quinolin-2-yl]methylideneamino]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 177495540 |
| Molecular Formula | C46H42N8O3 |
| Molecular Weight | 754.90 g/mol |
| Exact Mass | 754.34 |
| IUPAC Name | 2-[(E)-[8-[(1-benzyltriazol-4-yl)methoxy]quinolin-2-yl]methylideneamino]-3',6'-bis(ethylamino)-2',7'-dimethylspiro[isoindole-3,9'-xanthene]-1-one |
| SMILES | CCNc1cc2c(cc1C)C1(c3cc(C)c(NCC)cc3O2)c2ccccc2C(=O)N1/N=C/c1ccc2cccc(OCc3cn(Cc4ccccc4)nn3)c2n1 |
| InChI | InChI=1S/C46H42N8O3/c1-5-47-39-23-42-37(21-29(39)3)46(38-22-30(4)40(48-6-2)24-43(38)57-42)36-17-11-10-16-35(36)45(55)54(46)49-25-33-20-19-32-15-12-18-41(44(32)50-33)56-28-34-27-53(52-51-34)26-31-13-8-7-9-14-31/h7-25,27,47-48H,5-6,26,28H2,1-4H3/b49-25+ |
| InChIKey | GWHZXUITVCBZBI-ROKRGEHNSA-N |
| XLogP | 8.82 |
| TPSA | 118.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.90 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|