C29H34N3+3 — CID 177495576
1-[2-[4-[1-[2-(3,5-dimethylphenyl)ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium (PubChem CID 177495576) has the molecular formula C29H34N3+3 and a molecular weight of 424.61 g/mol. Its IUPAC name is 1-[2-[4-[1-[2-(3,5-dimethylphenyl)ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium.
| Compound Name | 1-[2-[4-[1-[2-(3,5-dimethylphenyl)ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium |
|---|---|
| PubChem CID | 177495576 |
| Molecular Formula | C29H34N3+3 |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 1-[2-[4-[1-[2-(3,5-dimethylphenyl)ethyl]pyridin-1-ium-4-yl]pyridin-1-ium-1-yl]ethyl]-3,5-dimethylpyridin-1-ium |
| SMILES | Cc1cc(C)cc(CC[n+]2ccc(-c3cc[n+](CC[n+]4cc(C)cc(C)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C29H34N3/c1-23-17-24(2)20-27(19-23)5-10-30-11-6-28(7-12-30)29-8-13-31(14-9-29)15-16-32-21-25(3)18-26(4)22-32/h6-9,11-14,17-22H,5,10,15-16H2,1-4H3/q+3 |
| InChIKey | QLRYLXCFZNKUAD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 11.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|